| Name |
cis-p-Coumaric acid (Z)-p-Coumaric acid |
| Formula |
C9H8O3 |
| Mw |
164.04734412 |
| CAS RN |
4501-31-9 |
| C_ID |
C00038791
, 
|
| InChIKey |
NGSWKAQJJWESNS-UTCJRWHESA-N |
| InChICode |
InChI=1S/C9H8O3/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6,10H,(H,11,12)/b6-3- |
| SMILES |
O=C(O)/C=Cc1ccc(O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Piperaceae | Peperomia duclouxii C. DC. | Ref. |
| Plantae | Poaceae | Cymbopogon citratus  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia frutescens | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis  | Ref. |
|
|
zoom in
| Organism | Scrophularia frutescens | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|