| Name |
Primulagenin A Schiwalligenin B1 |
| Formula |
C30H50O3 |
| Mw |
458.37599546 |
| CAS RN |
465-95-2 |
| C_ID |
C00037685
, 
|
| InChIKey |
YHGVYECWZWIVJC-MXUJYHJKNA-N |
| InChICode |
InChI=1S/C30H50O3/c1-25(2)14-15-30(18-31)20(16-25)19-8-9-22-27(5)12-11-23(32)26(3,4)21(27)10-13-28(22,6)29(19,7)17-24(30)33/h8,20-24,31-33H,9-18H2,1-7H3/t20-,21-,22+,23-,24+,27-,28+,29+,30+/m0/s1 |
| SMILES |
CC1(C)CC[C@]2(CO)[C@H](O)C[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC[C@H](O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Myrsinaceae | Aegiceras corniculatum | Ref. |
| Plantae | Myrsinaceae | Embelia schimperi  | Ref. |
| Plantae | Myrsinaceae | Lysimachia clethroides  | Ref. |
| Plantae | Myrsinaceae | Myrsine africana  | Ref. |
| Plantae | Primulaceae | Primula officinalis L.  | Ref. |
| Plantae | Primulaceae | Primula sieboldii | Ref. |
| Plantae | Theophrastaceae | Jacquinia pungens | Ref. |
|
|
zoom in
| Organism | Primula sieboldii | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|