| Name |
cis-Pinocamphone
cis-3-Pinanone
Isopinocamphone |
| Formula |
C10H16O |
| Mw |
152.12011513 |
| CAS RN |
15358-88-0 |
| C_ID |
C00037338
, 
|
| InChIKey |
MQPHVIPKLRXGDJ-ZJTYPKPZNA-N |
| InChICode |
InChI=1S/C10H16O/c1-6-8-4-7(5-9(6)11)10(8,2)3/h6-8H,4-5H2,1-3H3/t6-,7+,8-/m0/s1 |
| SMILES |
C[C@@H]1C(=O)C[C@H]2C[C@@H]1C2(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Ganodermataceae | Ganoderma lucidum  | Ref. |
| Plantae | Annonaceae | Xylopia parviflora | Ref. |
| Plantae | Annonaceae | Xylopia sericea | Ref. |
| Plantae | Asteraceae | Artemisia annua | Ref. |
| Plantae | Crassulaceae | Rhodiola rosea L. | Ref. |
| Plantae | Labiatae | Glechoma longituba | Ref. |
| Plantae | Pinaceae | Pinus halepensis | Ref. |
| Plantae | Pinaceae | Pinus sibirica | Ref. |
| Plantae | Turneraceae | Turnera diffusa | Ref. |
| Plantae | Zingiberaceae | Curcuma mangga | Ref. |
|
|
zoom in
| Organism | Glechoma longituba |
|---|
| Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11 |
|---|
|
