| Name |
1,6-Di-O-galloyl-beta-glucose 1,6-di-O-Galloyl-beta-D-glucose |
| Formula |
C20H20O14 |
| Mw |
484.08530535 |
| CAS RN |
23363-08-8 |
| C_ID |
C00037193
, 
|
| InChIKey |
ZVTDSJFUFCKPJJ-NPNPCUTLNA-N |
| InChICode |
InChI=1S/C9H18O7/c1-4-6(12)7(13)8(14)9(15-4)16-5(2-10)3-11/h4-14H,2-3H2,1H3/t4-,6-,7-,8+,9+/m1/s1 |
| SMILES |
C[C@H]1O[C@@H](OC(CO)CO)[C@@H](O)[C@H](O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Combretaceae | Terminalia chebula  | Ref. |
| Plantae | Fabaceae | Sophora japonica  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus emblica  | Ref. |
| Plantae | Polygonaceae | Rheum officinale  | Ref. |
| Plantae | Polygonaceae | Rheum palmatum  | Ref. |
| Plantae | Polygonaceae | Rheum tanguticum  | Ref. |
|
|
zoom in
| Organism | Rheum palmatum | | Reference | Leo, et al., Planta Med, 70, (2004), 841.
Zhang, et al., Journal of Natural Products, 64, (2001), 1527.
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993). |
|---|
|