| Name |
Leonuriside A 2,6-Dimethoxy-p-hydroquinone 1-O-beta-glucopyranoside |
| Formula |
C14H20O9 |
| Mw |
332.11073224 |
| CAS RN |
121748-12-7 |
| C_ID |
C00036467
, 
|
| InChIKey |
NOQYJICHFNSIFZ-HVOVEWBRNA-N |
| InChICode |
InChI=1S/C14H20O9/c1-20-7-3-6(16)4-8(21-2)13(7)23-14-12(19)11(18)10(17)9(5-15)22-14/h3-4,9-12,14-19H,5H2,1-2H3/t9-,10+,11+,12-,14+/m1/s1 |
| SMILES |
COc1cc(O)cc(OC)c1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Acanthus ilicifolius  | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Labiatae | Clerodendrum inerme  | Ref. |
| Plantae | Poaceae | Coix lachryma-jobi | Ref. |
| Plantae | Rosaceae | Prunus sp.  | Ref. |
| Plantae | Salicaceae | Salix matsudana | Ref. |
|
|
zoom in
| Organism | Salix matsudana | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|