| Name |
1,3-Dihydroxy-2-formylanthraquinone Nordamnacanthal |
| Formula |
C15H8O5 |
| Mw |
268.03717337 |
| CAS RN |
3736-59-2 |
| C_ID |
C00032078
, 
|
| InChIKey |
NSGZEHPFOUCUHD-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H8O5/c16-6-10-11(17)5-9-12(15(10)20)14(19)8-4-2-1-3-7(8)13(9)18/h1-6,17,20H |
| SMILES |
O=Cc1c(O)cc2c(c1O)C(=O)c1ccccc1C2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rubiaceae | Coprosma linariifolia Hook.f. | Ref. |
| Plantae | Rubiaceae | Damnacanthus indicus | Ref. |
| Plantae | Rubiaceae | Hymenodictyon excelsum  | Ref. |
| Plantae | Rubiaceae | Morinda citrifolia L.  | Ref. |
| Plantae | Rubiaceae | Morinda lucida  | Ref. |
| Plantae | Rubiaceae | Morinda pandurifolia | Ref. |
| Plantae | Rubiaceae | Morinda tinctoria  | Ref. |
| Plantae | Rubiaceae | Neonauclea calycina | Ref. |
| Plantae | Rubiaceae | Rubia cordifolia  | Ref. |
| Plantae | Rubiaceae | Rubia iberica | Ref. |
| Plantae | Rubiaceae | Rubia wallichiana DECNE  | Ref. |
|
|
zoom in
| Organism | Morinda pandurifolia | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|