| Name |
beta-Maaliene |
| Formula |
C15H24 |
| Mw |
204.18780077 |
| CAS RN |
489-29-2 |
| C_ID |
C00029818
, 
|
| InChIKey |
UPGLJTCDRBIZKP-ZFSGGJBSNA-N |
| InChICode |
InChI=1S/C15H24/c1-10-6-5-8-15(4)9-7-11-13(12(10)15)14(11,2)3/h11,13H,5-9H2,1-4H3/t11-,13-,15+/m1/s1 |
| SMILES |
CC1=C2[C@H]3[C@@H](CC[C@]2(C)CCC1)C3(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Asteraceae | Artemisia annua L.cultivar Jwarharti  | Ref. |
| Plantae | Asteraceae | Atractylodes lancea  | Ref. |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Valerianaceae | Nardostachys chinensis  | Ref. |
| - | - | Atemisia annua | Ref. |
|
|
zoom in
| Organism | Atemisia annua | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|