| Name |
8-Deoxygartanin 8-Desoxygartanin |
| Formula |
C23H24O5 |
| Mw |
380.16237388 |
| CAS RN |
33390-41-9 |
| C_ID |
C00029600
, 
|
| InChIKey |
GVQOVMKBYJKZSY-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C23H24O5/c1-12(2)8-10-14-19(25)16(11-9-13(3)4)23-18(20(14)26)21(27)15-6-5-7-17(24)22(15)28-23/h5-9,24-26H,10-11H2,1-4H3 |
| SMILES |
CC(C)=CCc1c(O)c(CC=C(C)C)c2oc3c(O)cccc3c(=O)c2c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum brasiliensis | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia dulcis  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia mangostana  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia merguensis | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia nigrolineata  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia speciosa | Ref. |
| Plantae | Clusiaceae-Guttiferae | Endodesmia calophylloides | Ref. |
| - | - | Toxylon pomiferum | Ref. |
|
|
zoom in
| Organism | Garcinia speciosa | | Reference | -
Deachathai, et al., Phytochemistry, 66, (2005), 2368.
Rukachaisirikul, et al., Journal of Natural Products, 66, (2003), 1531.
Huang, et al., Journal of Natural Products, 64, (2001), 903.
SUKSAMRARN, et al., Chem Pharm Bull, 54, (2006), 301. |
|---|
|