| Name |
N-trans-Coumaroyltyramine Paprazine N-p-Coumaroyl-tyramine trans-N-(p-Coumaroyl)tyramine |
| Formula |
C17H17NO3 |
| Mw |
283.12084342 |
| CAS RN |
36417-86-4 |
| C_ID |
C00028801
, 
|
| InChIKey |
RXGUTQNKCXHALN-BJMVGYQFSA-N |
| InChICode |
InChI=1S/C17H17NO3/c19-15-6-1-13(2-7-15)5-10-17(21)18-12-11-14-3-8-16(20)9-4-14/h1-10,19-20H,11-12H2,(H,18,21)/b10-5+ |
| SMILES |
O=C(/C=C/c1ccc(O)cc1)NCCc1ccc(O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Alliaceae | Allium chinense  | Ref. |
| Plantae | Annonaceae | Artabotrys uncinatus  | Ref. |
| Plantae | Asteraceae | Saussurea muliensis | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Fumariaceae | Fumaria indica  | Ref. |
| Plantae | Fumariaceae | Fumaria kralikii | Ref. |
| Plantae | Fumariaceae | Fumaria parviflora  | Ref. |
| Plantae | Menispermaceae | Tinospora crispa  | Ref. |
| Plantae | Piperaceae | Peperomia duclouxii C.DC. | Ref. |
| Plantae | Polygonaceae | Polygonum orientale  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Zygophyllaceae | Tribulus terrestris  | Ref. |
|
|
zoom in
| Organism | Fumaria kralikii | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|