| Name |
Muramine |
| Formula |
C22H27NO5 |
| Mw |
385.18892298 |
| CAS RN |
2292-20-8 |
| C_ID |
C00028614
, 
|
| InChIKey |
HUIJAZQRYSCNED-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C22H27NO5/c1-23-9-8-15-11-20(26-3)21(27-4)12-16(15)18(24)10-14-6-7-19(25-2)22(28-5)17(14)13-23/h6-7,11-12H,8-10,13H2,1-5H3 |
| SMILES |
COc1cc2c(cc1OC)C(=O)Cc1ccc(OC)c(OC)c1CN(C)CC2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fumariaceae | Corydalis esquirolii | Ref. |
| Plantae | Fumariaceae | Corydalis omeiensis | Ref. |
| Plantae | Fumariaceae | Corydalis pallida | Ref. |
| Plantae | Papaveraceae | Argemone munita Dur.et Hilg.subsp.rotunda(Rydb.)G.W.Ownb. | Ref. |
| Plantae | Papaveraceae | Papaver californicum | Ref. |
| Plantae | Papaveraceae | Papaver kerneri | Ref. |
| Plantae | Papaveraceae | Papaver nudicaule L. | Ref. |
|
|
zoom in
| Organism | Papaver kerneri | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|