| Name |
Vallesiachotamine |
| Formula |
C21H22N2O3 |
| Mw |
350.16304258 |
| CAS RN |
5523-37-5 |
| C_ID |
C00026074
, 
|
| InChIKey |
NTVLUSJWJRSPSM-MPJBBJCHNA-N |
| InChICode |
InChI=1S/C21H22N2O3/c1-3-13(12-24)16-10-19-20-15(14-6-4-5-7-18(14)22-20)8-9-23(19)11-17(16)21(25)26-2/h3-7,11-12,16,19,22H,8-10H2,1-2H3/b13-3-/t16-,19-/m0/s1 |
| SMILES |
C/C=C(/C=O)[C@@H]1C[C@H]2c3[nH]c4ccccc4c3CCN2C=C1C(=O)OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp Secologanin |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Alstonia scholaris  | Ref. |
| Plantae | Apocynaceae | Catharanthus roseus | Ref. |
| Plantae | Apocynaceae | Rauwolfia verticillata | Ref. |
| Plantae | Apocynaceae | Tabernaemontana psorocarpa (Pierre ex Stapf)Pichon | Ref. |
| Plantae | Rubiaceae | Chimarrhis turbinata | Ref. |
| Plantae | Rubiaceae | Uncaria rhynchophylla | Ref. |
|
|
zoom in
| Organism | Uncaria rhynchophylla |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993) |
|---|
|
