| Name |
Juziphine (+)-Juziphine Yuziphine |
| Formula |
C18H21NO3 |
| Mw |
299.15214354 |
| CAS RN |
64091-05-0 |
| C_ID |
C00025924
, 
|
| InChIKey |
QRKWLDOOAQAGAE-GGYSOQFKNA-N |
| InChICode |
InChI=1S/C18H21NO3/c1-19-10-9-13-5-8-16(22-2)18(21)17(13)15(19)11-12-3-6-14(20)7-4-12/h3-8,15,20-21H,9-11H2,1-2H3/t15-/m1/s1 |
| SMILES |
COc1ccc2c(c1O)[C@@H](Cc1ccc(O)cc1)N(C)CC2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr L-Phe |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Guatteria goudotiana | Ref. |
| Plantae | Fumariaceae | Ceratocapnos palaestinus | Ref. |
| Plantae | Fumariaceae | Corydalis bungeana  | Ref. |
| Plantae | Fumariaceae | Corydalis claviculata | Ref. |
| Plantae | Fumariaceae | Fumaria bastardii | Ref. |
| Plantae | Fumariaceae | Fumaria vaillantii  | Ref. |
| Plantae | Lauraceae | Litsea acuminata | Ref. |
| Plantae | Lauraceae | Nectandra salicifolia | Ref. |
| Plantae | Lauraceae | Neolitsea villosa | Ref. |
| Plantae | Lauraceae | Phoebe formosana | Ref. |
| Plantae | Lauraceae | Phoebe minutiflora | Ref. |
| Plantae | Menispermaceae | Stephania cepharantha Hayata  | Ref. |
| Plantae | Menispermaceae | Tiliacora dinklagei Engl. | Ref. |
|
|
zoom in
| Organism | Fumaria vaillantii | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|