| Name |
Micheline A Ushinsunine (-)-Ushinsunine Micheline A |
| Formula |
C18H17NO3 |
| Mw |
295.12084342 |
| CAS RN |
3175-89-1 |
| C_ID |
C00025258
, 
|
| InChIKey |
NVMGTUCOAQKLLO-LQKAMQBPNA-N |
| InChICode |
InChI=1S/C18H17NO3/c1-19-7-6-10-8-13-18(22-9-21-13)15-11-4-2-3-5-12(11)17(20)16(19)14(10)15/h2-5,8,16-17,20H,6-7,9H2,1H3/t16-,17+/m0/s1 |
| SMILES |
CN1CCc2cc3c(c4c2[C@H]1[C@H](O)c1ccccc1-4)OCO3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
Anthranilate |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Annona cherimola  | Ref. |
| Plantae | Annonaceae | Artabotrys maingayi | Ref. |
| Plantae | Annonaceae | Cananga odorata  | Ref. |
| Plantae | Magnoliaceae | Michelia alba | Ref. |
| Plantae | Magnoliaceae | Michelia champaca  | Ref. |
| Plantae | Magnoliaceae | Michelia compressa var.formosana | Ref. |
| Plantae | Menispermaceae | Stephania epigaea H.S.Lo | Ref. |
| Plantae | Menispermaceae | Stephania venosa (Bl.) Spreng. | Ref. |
| Plantae | Menispermaceae | Stephania venosa Spreng | Ref. |
|
|
zoom in
| Organism | Michelia compressa var.formosana | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|