| Name |
Lupenone |
| Formula |
C30H48O |
| Mw |
424.37051615 |
| CAS RN |
1617-70-5 |
| C_ID |
C00019220
, 
|
| InChIKey |
GRBHNQFQFHLCHO-DYWULMQRNA-N |
| InChICode |
InChI=1S/C30H48O/c1-19(2)20-11-14-27(5)17-18-29(7)21(25(20)27)9-10-23-28(6)15-13-24(31)26(3,4)22(28)12-16-30(23,29)8/h20-23,25H,1,9-18H2,2-8H3/t20-,21+,22-,23+,25-,27+,28-,29+,30+/m0/s1 |
| SMILES |
C=C(C)[C@@H]1CC[C@]2(C)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CCC(=O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Strobilanthes cusia  | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Asteraceae | Chuquiraga ulicina ssp. ulicina | Ref. |
| Plantae | Asteraceae | Scorzonera cretica | Ref. |
| Plantae | Asteraceae | Senecio chionophilus | Ref. |
| Plantae | Betulaceae | Alnus japonica  | Ref. |
| Plantae | Celastraceae | Celastrus hindsii BENTH | Ref. |
| Plantae | Celastraceae | Maytenus chiapensis | Ref. |
| Plantae | Celastraceae | Maytenus cuzcoina | Ref. |
| Plantae | Combretaceae | Terminalia brasiliensis | Ref. |
| Plantae | Ebenaceae | Diospyros mollis  | Ref. |
| Plantae | Ebenaceae | Diospyros rhodocalyx | Ref. |
| Plantae | Euphorbiaceae | Croton arboreous | Ref. |
| Plantae | Euphorbiaceae | Euphorbia helioscopia  | Ref. |
| Plantae | Euphorbiaceae | Euphorbia segetalis  | Ref. |
| Plantae | Euphorbiaceae | Euphorbia stygiana | Ref. |
| Plantae | Euphorbiaceae | Manihot esculenta  | Ref. |
| Plantae | Fabaceae | Acacia mellifera  | Ref. |
| Plantae | Fabaceae | Acacia pennatula | Ref. |
| Plantae | Fabaceae | Albizia gummifera  | Ref. |
| Plantae | Fabaceae | Anadenanthera colubrine | Ref. |
| Plantae | Fabaceae | Derris oblonga | Ref. |
| Plantae | Fabaceae | Millettia pinnata | Ref. |
| Plantae | Fabaceae | Piptadenia macrocarpa | Ref. |
| Plantae | Fabaceae | Pongamia pinnata  | Ref. |
| Plantae | Fabaceae | Pterocarpus santalinus  | Ref. |
| Plantae | Fabaceae | Tephrosia toxicaria | Ref. |
| Plantae | Fabaceae | Tephrosia villosa  | Ref. |
| Plantae | Lardizabalaceae | Stauntonia obovatifoliola Hayata subsp.intermedia | Ref. |
| Plantae | Lauraceae | Neolitsea konishii | Ref. |
| Plantae | Lauraceae | Neolitsea parvigemma | Ref. |
| Plantae | Malvaceae | Firmiana simplex  | Ref. |
| Plantae | Meliaceae | Aglaia forbesii  | Ref. |
| Plantae | Phyllanthaceae | Glochidion puberum | Ref. |
| Plantae | Rhizophoraceae | Bruguiera parviflora  | Ref. |
| Plantae | Rubiaceae | Lasianthus gardneri | Ref. |
| Plantae | Rutaceae | Phellodendron amurense  | Ref. |
| Plantae | Rutaceae | Phellodendron japonicum MAXIM | Ref. |
|
|
zoom in
| Organism | Alnus japonica | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Chumkaew, et al., Chem Pharm Bull, 53, (2005), 95.
Mutai, et al., Phytochemistry, 65, (2004), 1159.
CHIU, et al., Chem Pharm Bull, 53, (2005), 1118.
Jang, et al., Journal of Natural Products, 66, (2003), 1166.
Carcache-Blanco, et al., Journal of Natural Products, 66, (2003), 1197.
Wu, et al., Journal of Natural Products, 66, (2003), 1207.
Gutierrez-Lugo, et al., Planta Med, 70, (2004), 263.
Chaturvedula, et al., Planta Med, 69, (2003), 271 |
|---|
|