| Name |
2-Geranyl-3,5-dihydroxybibenzyl |
| Formula |
C24H30O2 |
| Mw |
350.2245802 |
| CAS RN |
120467-08-5 |
| C_ID |
C00015268
, 
|
| InChIKey |
UOVQVQCTFRPVOW-XDHOZWIPSA-N |
| InChICode |
InChI=1S/C24H30O2/c1-18(2)8-7-9-19(3)12-15-23-21(16-22(25)17-24(23)26)14-13-20-10-5-4-6-11-20/h4-6,8,10-12,16-17,25-26H,7,9,13-15H2,1-3H3/b19-12+ |
| SMILES |
CC(C)=CCC/C(C)=C/Cc1c(O)cc(O)cc1CCc1ccccc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| - | - | Radula complanata | Ref. |
| - | - | Radula frondescens | Ref. |
| - | - | Radula javanica | Ref. |
| - | - | Radula kojana | Ref. |
| - | - | Radula oyamensis | Ref. |
| - | - | Radula tokiensis | Ref. |
| - | - | Radula voluta | Ref. |
|
|
zoom in
| Organism | Radula tokiensis | | Reference | Asakawa,Chemical constituents of Hepaticae, in Progress in the Chemistry of Organic Natural Products,Springer,Vienna,(1982),1 |
|---|
|