| Name |
Neoechinulin A |
| Formula |
C19H21N3O2 |
| Mw |
323.16337694 |
| CAS RN |
51551-29-2 |
| C_ID |
C00011284
, 
|
| InChIKey |
MYRPIYZIAHOECW-GDNBJRDFNA-N |
| InChICode |
InChI=1S/C19H21N3O2/c1-5-19(3,4)16-13(12-8-6-7-9-14(12)21-16)10-15-18(24)20-11(2)17(23)22-15/h5-11,21H,1H2,2-4H3,(H,20,24)(H,22,23)/b15-10-/t11-/m1/s1 |
| SMILES |
C=CC(C)(C)c1[nH]c2ccccc2c1/C=C1NC(=O)C(C)NC1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp Anthranilate |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Chaetomiaceae | Chaetomium globasum | Ref. |
| Fungi | Trichocomaceae | Aspergillus sp. | Ref. |
| Fungi | Trichocomaceae | Aspergillus variecolor | Ref. |
| Fungi | Trichocomaceae | Eurotium amstelodami | Ref. |
| Fungi | Trichocomaceae | Eurotium rubrum | Ref. |
| Plantae | Plumbaginaceae | Plumbago zeylanica  | Ref. |
|
|
zoom in
| Organism | Plumbago zeylanica | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|