| Name |
alpha-Cymene o-Cymol 0-Isopropyltoluene 1-Isopropyl-2-methylbenzene o-Cymene 2-Isopropyltoluene |
| Formula |
C10H14 |
| Mw |
134.10955045 |
| CAS RN |
527-84-4 |
| C_ID |
C00010974
, 
|
| InChIKey |
WWRCMNKATXZARA-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C10H14/c1-8(2)10-7-5-4-6-9(10)3/h4-8H,1-3H3 |
| SMILES |
Cc1ccccc1C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens (Urine) | Ref. |
| Fungi | Ganodermataceae | Ganoderma lucidum  | Ref. |
| Fungi | Trichocomaceae | Penicillium expansum | Ref. |
| Plantae | Annonaceae | Xylopia sericea  | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Apocynaceae | Tabernaemontana catharinensis | Ref. |
| Plantae | Asteraceae | Artemisia anethoides | Ref. |
| Plantae | Asteraceae | Centaurea atropurpurea | Ref. |
| Plantae | Asteraceae | Centaurea orientalis | Ref. |
| Plantae | Asteraceae | Lychnophora ericoides Mart.  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Illiciaceae | Illicium anisatum  | Ref. |
| Plantae | Labiatae | Clinopodium nepeta | Ref. |
| Plantae | Labiatae | Lavandula angustifolia  | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
| Plantae | Labiatae | Thymus capitatus  | Ref. |
| Plantae | Labiatae | Thymus vulgaris  | Ref. |
| Plantae | Myrtaceae | Acca sellowiana | Ref. |
| Plantae | Pinaceae | Pinus sibirica | Ref. |
| Plantae | Piperaceae | Piper nigrum  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rutaceae | Atalantia guillauminii | Ref. |
| Plantae | Rutaceae | Citrus aurantium  | Ref. |
| Plantae | Rutaceae | Zanthoxylum armatum  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Tabernaemontana catharinensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|