| Name |
Ligstroside (-)-Ligstroside |
| Formula |
C25H32O12 |
| Mw |
524.18937649 |
| CAS RN |
35897-92-8 |
| C_ID |
C00010785
, 
|
| InChIKey |
GMQXOLRKJQWPNB-AADWTEDDNA-N |
| InChICode |
InChI=1S/C25H32O12/c1-3-15-16(10-19(28)34-9-8-13-4-6-14(27)7-5-13)17(23(32)33-2)12-35-24(15)37-25-22(31)21(30)20(29)18(11-26)36-25/h3-7,12,16,18,20-22,24-27,29-31H,8-11H2,1-2H3/b15-3+/t16-,18+,20+,21-,22-,24-,25-/m0/s1 |
| SMILES |
C/C=C1/[C@H](O[C@@H]2OC(CO)[C@@H](O)C(O)[C@@H]2O)OC=C(C(=O)OC)[C@H]1CC(=O)OCCc1ccc(O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Oleaceae | Fraxinus americana | Ref. |
| Plantae | Oleaceae | Fraxinus excelsior  | Ref. |
| Plantae | Oleaceae | Fraxinus insularis | Ref. |
| Plantae | Oleaceae | Fraxinus ornus  | Ref. |
| Plantae | Oleaceae | Fraxinus oxycarba | Ref. |
| Plantae | Oleaceae | Jasminum grandiflorum  | Ref. |
| Plantae | Oleaceae | Jasminum officinale  | Ref. |
| Plantae | Oleaceae | Ligustrum lucidum  | Ref. |
| Plantae | Oleaceae | Ligustrum obtusifolium  | Ref. |
| Plantae | Oleaceae | Olea europaea L.  | Ref. |
| Plantae | Oleaceae | Phillyrea media  | Ref. |
| Plantae | Oleaceae | Syringa afghanica | Ref. |
| Plantae | Oleaceae | Syringa vulgaris L.  | Ref. |
|
|
zoom in
| Organism | Jasminum grandiflorum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|