| Name |
Teuhircoside |
| Formula |
C15H20O9 |
| Mw |
344.11073224 |
| CAS RN |
80135-40-6 |
| C_ID |
C00010717
, 
|
| InChIKey |
JTUGHXNNGQUKSQ-BCXWWPBJNA-N |
| InChICode |
InChI=1S/C15H20O9/c1-6-4-8(17)15(21)2-3-22-13(9(6)15)24-14-12(20)11(19)10(18)7(5-16)23-14/h2-4,7,9-14,16,18-21H,5H2,1H3/t7-,9+,10-,11+,12+,13+,14-,15+/m1/s1 |
| SMILES |
CC1=CC(=O)[C@]2(O)C=CO[C@@H](OC3OC(CO)[C@@H](O)C(O)[C@@H]3O)[C@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Ajuga taiwanensis | Ref. |
| Plantae | Labiatae | Ajuga tawanensis | Ref. |
| Plantae | Labiatae | Teucrium arduini  | Ref. |
| Plantae | Labiatae | Teucrium hircanicum | Ref. |
| Plantae | Labiatae | Teucrium hyrcanicum | Ref. |
| Plantae | Scrophulariaceae | Scrophularia ningpoensis  | Ref. |
|
|
zoom in
| Organism | Scrophularia ningpoensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|