| Name |
Lupiwighteone 5,7,4'-Trihydroxy-8-prenylisoflavone |
| Formula |
C20H18O5 |
| Mw |
338.11542369 |
| CAS RN |
104691-86-3 |
| C_ID |
C00009896
, 
|
| InChIKey |
YGCCASGFIOIXIN-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H18O5/c1-11(2)3-8-14-16(22)9-17(23)18-19(24)15(10-25-20(14)18)12-4-6-13(21)7-5-12/h3-7,9-10,21-23H,8H2,1-2H3 |
| SMILES |
CC(C)=CCc1c(O)cc(O)c2c(=O)c(-c3ccc(O)cc3)coc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Derris scandens  | Ref. |
| Plantae | Fabaceae | Erythrina variegata L.  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza inflata  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
| Plantae | Fabaceae | Lupinus luteus  | Ref. |
| Plantae | Fabaceae | Pueraria montana var. lobata | Ref. |
| Plantae | Fabaceae | Vigna angularis  | Ref. |
| Plantae | Zingiberaceae | Curcuma mangga  | Ref. |
|
|
zoom in
| Organism | Lupinus luteus | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Erasto, et al., Phytochemistry, 65, (2004), 875.
Mahabusarakama, et al., Phytochemistry, 65, (2004), 1185
Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Hashidoko,Agric.Biol.Chem.,50,(1986),1797
Abe,Agric.Biol.Chem.,51,(1987),349 |
|---|
|