| Name |
Isoderrone 5,7-Dihydroxy-6'',6''-dimethylpyrano[2'',3'':4',3']isoflavone |
| Formula |
C20H16O5 |
| Mw |
336.09977362 |
| CAS RN |
121747-89-5 |
| C_ID |
C00009873
, 
|
| InChIKey |
WTNXJYOYGPGIJK-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H16O5/c1-20(2)6-5-12-7-11(3-4-16(12)25-20)14-10-24-17-9-13(21)8-15(22)18(17)19(14)23/h3-10,21-22H,1-2H3 |
| SMILES |
CC1(C)C=Cc2cc(-c3coc4cc(O)cc(O)c4c3=O)ccc2O1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Erythrina vogelii | Ref. |
| Plantae | Fabaceae | Genista corsica | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza inflata  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
| Plantae | Fabaceae | Lupinus albus  | Ref. |
| Plantae | Fabaceae | Ulex jussiaei | Ref. |
| Plantae | Fabaceae | Ulex minor | Ref. |
| Plantae | Fabaceae | Ulex parviflorus | Ref. |
|
|
zoom in
| Organism | Lupinus albus | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Tahara,Phytochem.,28,,(1989),901 |
|---|
|