| Name |
Folitenol |
| Formula |
C25H26O4 |
| Mw |
390.18310932 |
| CAS RN |
26992-37-0 |
| C_ID |
C00009664
, 
|
| InChIKey |
XERSCIKBWOLVNC-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C25H26O4/c1-14(2)5-6-15-11-18-22(12-20(15)26)27-13-19-16-7-8-21-17(23(16)28-24(18)19)9-10-25(3,4)29-21/h5,7-12,19,24,26H,6,13H2,1-4H3/t19-,24-/m1/s1 |
| SMILES |
CC(C)=CCc1cc2c(cc1O)OCC1c3ccc4c(c3OC21)C=CC(C)(C)O4 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Erythrina orientalis | Ref. |
| Plantae | Fabaceae | Erythrina poeppigiana  | Ref. |
| Plantae | Fabaceae | Erythrina variegata  | Ref. |
| Plantae | Fabaceae | Erythrina zeyheri | Ref. |
| Plantae | Fabaceae | Lespedeza floribunda | Ref. |
| Plantae | Fabaceae | Neorautanenia ficifolia | Ref. |
|
|
zoom in
| Organism | Neorautanenia ficifolia | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Brink,J.S.Afr.Chem.Inst.,23,(1970),24 |
|---|
|