| Name |
Auriculasin Cudraisoflavone A |
| Formula |
C25H24O6 |
| Mw |
420.1572885 |
| CAS RN |
60297-37-2 |
| C_ID |
C00009522
, 
|
| InChIKey |
PSEBCAMYGWGJMH-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C25H24O6/c1-13(2)5-7-16-23-15(9-10-25(3,4)31-23)21(28)20-22(29)17(12-30-24(16)20)14-6-8-18(26)19(27)11-14/h5-6,8-12,26-28H,7H2,1-4H3 |
| SMILES |
CC(C)=CCc1c2c(c(O)c3c(=O)c(-c4ccc(O)c(O)c4)coc13)C=CC(C)(C)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Bupleurum scorzonerifolium  | Ref. |
| Plantae | Asphodelaceae | Aloe vera  | Ref. |
| Plantae | Convolvulaceae | Erycibe expansa  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum ulei | Ref. |
| Plantae | Fabaceae | Millettia auriculata  | Ref. |
| Plantae | Fabaceae | Millettia taiwaniana | Ref. |
| Plantae | Fabaceae | Ormosia monosperma | Ref. |
| Plantae | Myrtaceae | Acca sellowiana | Ref. |
| - | - | Milletia auriculata | Ref. |
| - | - | Moghania philippinensis | Ref. |
| - | - | Sarcolobus globosus | Ref. |
|
|
zoom in
| Organism | Millettia auriculata | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Minhaj,Tetrahedron,32,(1976),749
Raju,Phytochem.,17,(1978),1065 |
|---|
|