| Name |
Warangalone Scandenone |
| Formula |
C25H24O5 |
| Mw |
404.16237388 |
| CAS RN |
4449-55-2 |
| C_ID |
C00009514
, 
|
| InChIKey |
HGHOPAZIUPORIN-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C25H24O5/c1-14(2)5-10-18-23-17(11-12-25(3,4)30-23)21(27)20-22(28)19(13-29-24(18)20)15-6-8-16(26)9-7-15/h5-9,11-13,26-27H,10H2,1-4H3 |
| SMILES |
CC(C)=CCc1c2c(c(O)c3c(=O)c(-c4ccc(O)cc4)coc13)C=CC(C)(C)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Bupleurum scorzonerifolium  | Ref. |
| Plantae | Asphodelaceae | Aloe vera  | Ref. |
| Plantae | Convolvulaceae | Erycibe expansa  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum ulei | Ref. |
| Plantae | Fabaceae | Derris scandens  | Ref. |
| Plantae | Fabaceae | Erythrina addisoniae | Ref. |
| Plantae | Fabaceae | Erythrina senegalensis  | Ref. |
| Plantae | Fabaceae | Erythrina sigmoidea | Ref. |
| Plantae | Fabaceae | Erythrina variegata  | Ref. |
| Plantae | Fabaceae | Erythrina vogelii | Ref. |
| Plantae | Fabaceae | Euchresta japonica  | Ref. |
| Plantae | Fabaceae | Millettia auriculata  | Ref. |
| Plantae | Fabaceae | Millettia taiwaniana | Ref. |
| Plantae | Fabaceae | Ormosia monosperma | Ref. |
| Plantae | Fabaceae | Tephrosia elata  | Ref. |
| Plantae | Myrtaceae | Acca sellowiana | Ref. |
| - | - | Sarcolobus globosus | Ref. |
|
|
zoom in
| Organism | Derris scandens | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Falshaw,J.Chem.Soc.C,(1969),374
Pelter,J.Chem.Soc.C.,(1966),701 |
|---|
|