| Name |
3'-Methylorobol 3'-O-Methylorobol Orobol 3'-methyl ether |
| Formula |
C16H12O6 |
| Mw |
300.06338812 |
| CAS RN |
36190-95-1 |
| C_ID |
C00009458
, 
|
| InChIKey |
ZMFBGWWGXBNJAC-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O6/c1-21-13-4-8(2-3-11(13)18)10-7-22-14-6-9(17)5-12(19)15(14)16(10)20/h2-7,17-19H,1H3 |
| SMILES |
COc1cc(-c2coc3cc(O)cc(O)c3c2=O)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Anaxagorea luzonensis A.GRAY | Ref. |
| Plantae | Asteraceae | Wyethia helenioides | Ref. |
| Plantae | Asteraceae | Wyethia mollis | Ref. |
| Plantae | Convolvulaceae | Erycibe expansa  | Ref. |
| Plantae | Fabaceae | Cytisus scoparius  | Ref. |
| Plantae | Fabaceae | Dalbergia inundata | Ref. |
| Plantae | Fabaceae | Dalbergia parviflora  | Ref. |
| Plantae | Fabaceae | Derris scandens  | Ref. |
| Plantae | Fabaceae | Lupinus albus  | Ref. |
| Plantae | Fabaceae | Thermopsis spp. | Ref. |
| Plantae | Moraceae | Cudrania cochinchinensis  | Ref. |
| - | - | Moghania philippinensis | Ref. |
|
|
zoom in
| Organism | Dalbergia inundata | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Leite de Almeida,Phytochem.,13,(1974),751
Dement,Phytochem.,11,(1972),1089 |
|---|
|