| Name |
3'-Methoxydaidzein |
| Formula |
C16H12O5 |
| Mw |
284.06847349 |
| CAS RN |
21913-98-4 |
| C_ID |
C00009390
, 
|
| InChIKey |
MUYAUELJBWQNDH-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O5/c1-20-15-6-9(2-5-13(15)18)12-8-21-14-7-10(17)3-4-11(14)16(12)19/h2-8,17-18H,1H3 |
| SMILES |
COc1cc(-c2coc3cc(O)ccc3c2=O)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Andira inermis  | Ref. |
| Plantae | Fabaceae | Caragana jubata | Ref. |
| Plantae | Fabaceae | Cyclolobium claussenii | Ref. |
| Plantae | Fabaceae | Dalbergia odorifera  | Ref. |
| Plantae | Fabaceae | Dalbergia parviflora  | Ref. |
| Plantae | Fabaceae | Maackia amurensis  | Ref. |
| Plantae | Fabaceae | Machaerium villosum | Ref. |
|
|
zoom in
| Organism | Maackia amurensis | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Takai,Chem.Pharm.Bull.,20,(1972),2488
Braga de Oliveira,An Acad.Brasil.Cie[ac]nc.,43,(1971),129 |
|---|
|