| Name |
Cinnamtannin B1 |
| Formula |
C45H36O18 |
| Mw |
864.19016435 |
| CAS RN |
88082-60-4 |
| C_ID |
C00009291
, 
|
| InChIKey |
BYSRPHRKESMCPO-LYUZXYPXNA-N |
| InChICode |
InChI=1S/C45H36O18/c46-18-10-27(54)33-31(11-18)62-45(17-3-6-22(49)26(53)9-17)44(59)38(33)36-32(63-45)14-29(56)35-37(39(58)41(61-43(35)36)16-2-5-21(48)25(52)8-16)34-28(55)13-23(50)19-12-30(57)40(60-42(19)34)15-1-4-20(47)24(51)7-15/h1-11,13-14,30,37-41,44,46-59H,12H2/t30-,37-,38-,39-,40-,41-,44-,45+/m1/s1 |
| SMILES |
Oc1cc(O)c2c(c1)O[C@@]1(c3ccc(O)c(O)c3)Oc3cc(O)c4c(c3[C@@H]2[C@H]1O)O[C@H](c1ccc(O)c(O)c1)[C@H](O)[C@H]4c1c(O)cc(O)c2c1O[C@H](c1ccc(O)c(O)c1)[C@H](O)C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Parameria laevigata MOLDENKE  | Ref. |
| Plantae | Ericaceae | Vaccinium vitis-idaea  | Ref. |
| Plantae | Gleicheniaceae | Dicranopteris pedata | Ref. |
| Plantae | Lauraceae | Cinnamomum sieboldii  | Ref. |
| Plantae | Lauraceae | Cinnamomum zeylanicum  | Ref. |
| Plantae | Lauraceae | Lindera umbellata  | Ref. |
| Plantae | Rhizophoraceae | Kandelia candel | Ref. |
| Plantae | Sapindaceae | Aesculus hippocastanum  | Ref. |
|
|
zoom in
| Organism | Lindera umbellata | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Nonaka,J.Chem.Soc.Perkin Trans,1,(1983),2139
Morimoto,Chem.Pharm.Bull.,36,(1988),33 |
|---|
|