| Name |
Epicatechin-(4beta->8)-epicatechin-(4beta->6)-epicatechin |
| Formula |
C45H38O18 |
| Mw |
866.20581441 |
| CAS RN |
88903-74-6 |
| C_ID |
C00009090
, 
|
| InChIKey |
PBYRKMXDROOXMU-NPBBBJTQNA-N |
| InChICode |
InChI=1S/C45H38O18/c46-18-10-26(53)33-32(11-18)62-43(16-2-5-21(48)24(51)8-16)40(59)37(33)35-27(54)13-28(55)36-38(41(60)44(63-45(35)36)17-3-6-22(49)25(52)9-17)34-29(56)14-31-19(39(34)58)12-30(57)42(61-31)15-1-4-20(47)23(50)7-15/h1-11,13-14,30,37-38,40-44,46-60H,12H2/t30-,37+,38-,40+,41+,42-,43+,44+/m0/s1 |
| SMILES |
Oc1cc(O)c2c(c1)O[C@H](c1ccc(O)c(O)c1)[C@H](O)[C@H]2c1c(O)cc(O)c2c1O[C@H](c1ccc(O)c(O)c1)[C@H](O)[C@H]2c1c(O)cc2c(c1O)C[C@@H](O)[C@@H](c1ccc(O)c(O)c1)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Davalliaceae | Davallia divaricata | Ref. |
| Plantae | Davalliaceae | Davallia mariesii | Ref. |
| Plantae | Rosaceae | Crataegus laevigata  | Ref. |
| Plantae | Rosaceae | Malus pumila  | Ref. |
| Plantae | Rosaceae | Rhaphiolepis umbellata | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
|
|
zoom in
| Organism | Vitis vinifera | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Ezaki-Furuichi,Agric.Biol.Chem.,50,(1986),2061 |
|---|
|