| Name |
Ourateaproanthocyanidin A |
| Formula |
C31H28O12 |
| Mw |
592.15807636 |
| CAS RN |
18206-61-6 |
| C_ID |
C00009061
, 
|
| InChIKey |
JPFCOVZKLAXXOE-ZPNYQRGRNA-N |
| InChICode |
InChI=1S/C31H28O12/c1-41-31-20(37)6-13(7-21(31)38)28-22(39)10-16-17(34)11-19(36)25(30(16)43-28)26-24-18(35)8-15(33)9-23(24)42-29(27(26)40)12-2-4-14(32)5-3-12/h2-9,11,22,26-29,32-40H,10H2,1H3/t22-,26+,27+,28-,29+/m0/s1 |
| SMILES |
COc1c(O)cc([C@H]2Oc3c(c(O)cc(O)c3[C@H]3c4c(O)cc(O)cc4O[C@H](c4ccc(O)cc4)[C@@H]3O)C[C@H]2O)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Celastraceae | Elaeodendron balae | Ref. |
| Plantae | Celastraceae | Maytenus loevis | Ref. |
| Plantae | Celastraceae | Maytenus rigida | Ref. |
| Plantae | Celastraceae | Prionostemma aspera  | Ref. |
| Plantae | Erythropalaceae | Heisteria pallida | Ref. |
| Plantae | Ochnaceae | Ouratea sp. | Ref. |
|
|
zoom in
| Organism | Ouratea sp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Delle Monache,Tetrahedron Lett.,26,(1967),4211
Drewes,Phytochem.,32,(1993),1041 |
|---|
|