| Name |
Padmatin |
| Formula |
C16H14O7 |
| Mw |
318.0739528 |
| CAS RN |
80453-44-7 |
| C_ID |
C00008577
, 
|
| InChIKey |
MRPJBTFHICBFNE-REIYMHPCNA-N |
| InChICode |
InChI=1S/C16H14O7/c1-22-8-5-11(19)13-12(6-8)23-16(15(21)14(13)20)7-2-3-9(17)10(18)4-7/h2-6,15-19,21H,1H3/t15-,16-/m1/s1 |
| SMILES |
COc1cc(O)c2c(c1)O[C@H](c1ccc(O)c(O)c1)[C@@H](O)C2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Artemisia campestris  | Ref. |
| Plantae | Asteraceae | Artemisia glutinosa | Ref. |
| Plantae | Asteraceae | Inula graveolens | Ref. |
| Plantae | Asteraceae | Inula viscosa  | Ref. |
| Plantae | Asteraceae | Pulicaria undulata  | Ref. |
| Plantae | Asteraceae | Trixis vanthrei | Ref. |
| Plantae | Rosaceae | Prunus puddum  | Ref. |
|
|
zoom in
| Organism | Trixis vanthrei | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 697,Flavanones and dihydroflavonols
Goel,Tetrahedron,5,(1959),91
Abdel-Mogib,Pharmazie,44,(1989),801 |
|---|
|