| Name |
Maesopsin |
| Formula |
C15H12O6 |
| Mw |
288.06338812 |
| CAS RN |
5989-16-2 |
| C_ID |
C00008066
, 
|
| InChIKey |
LOFYFDPXORJJEE-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C15H12O6/c16-9-3-1-8(2-4-9)7-15(20)14(19)13-11(18)5-10(17)6-12(13)21-15/h1-6,16-18,20H,7H2/t15-/m1/s1 |
| SMILES |
O=C1c2c(O)cc(O)cc2OC1(O)Cc1ccc(O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Polygonaceae | Rheum emodi  | Ref. |
| Plantae | Polygonaceae | Rheum nanum | Ref. |
| Plantae | Rhamnaceae | Alphitonia whitei | Ref. |
| Plantae | Rhamnaceae | Maesopsis eminii  | Ref. |
| Plantae | Rhamnaceae | Phyllogeiton zeyheri | Ref. |
| - | - | Rgeum emodi | Ref. |
|
|
zoom in
| Organism | Rgeum emodi | | Reference | Krenn, et al., Journal of Natural Products, 66, (2003), 1107.
Xiang, et al., Chinese Traditional and Herbal Drugs(Zhongcaoyao), 36, (2005), 1306 |
|---|
|