| Name |
Rengasin |
| Formula |
C16H12O6 |
| Mw |
300.06338812 |
| CAS RN |
54826-89-0 |
| C_ID |
C00008028
, 
|
| InChIKey |
ZUJPCSCNGYJPAF-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O6/c1-21-12-6-9(17)7-13-15(12)16(20)14(22-13)5-8-2-3-10(18)11(19)4-8/h2-7,17-19H,1H3/b14-5- |
| SMILES |
COc1cc(O)cc2c1C(=O)C(=Cc1ccc(O)c(O)c1)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Actinocheita filicina | Ref. |
| Plantae | Anacardiaceae | Amphipterygium adstringens | Ref. |
| Plantae | Anacardiaceae | Anacardium excelsum | Ref. |
| Plantae | Anacardiaceae | Cotinus obovatus | Ref. |
| Plantae | Anacardiaceae | Melanorrhoea aptera | Ref. |
| Plantae | Anacardiaceae | Metopium brownei | Ref. |
| Plantae | Anacardiaceae | Rhus spp. | Ref. |
| Plantae | Anacardiaceae | Swintonia luzonensis | Ref. |
| Plantae | Anacardiaceae | Toxicodendron diversilobum | Ref. |
|
|
zoom in
| Organism | Metopium brownei | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
Farmas,Tetrahedron Lett.,(1963),1999
Ogiyama,Phytochem.,15,81976),2025 |
|---|
|