| Name |
Cryptomerin A |
| Formula |
C31H20O10 |
| Mw |
552.10564686 |
| CAS RN |
22012-97-1 |
| C_ID |
C00006536
, 
|
| InChIKey |
JLHZOLWNLOEMKU-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C31H20O10/c1-38-18-6-2-15(3-7-18)25-13-22(35)29-27(41-25)14-23(36)31(30(29)37)39-19-8-4-16(5-9-19)24-12-21(34)28-20(33)10-17(32)11-26(28)40-24/h2-14,32-33,36-37H,1H3 |
| SMILES |
COc1ccc(-c2cc(=O)c3c(O)c(Oc4ccc(-c5cc(=O)c6c(O)cc(O)cc6o5)cc4)c(O)cc3o2)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cupressaceae | Chamaecyparis obtusa | Ref. |
| Plantae | Cupressaceae | Chamaecyparis pisifera | Ref. |
| Plantae | Cupressaceae | Cupressus spp. | Ref. |
| Plantae | Cupressaceae | Juniperus chinensis | Ref. |
| Plantae | Cupressaceae | Thujopsis dolabrata | Ref. |
| Plantae | Podocarpaceae | Podocarpus macrophyllus  | Ref. |
| Plantae | Taxodiaceae | Cryptomeria japonica | Ref. |
| Plantae | Taxodiaceae | Glyptostrobus lineatus | Ref. |
| Plantae | Taxodiaceae | Metasequoia spp. | Ref. |
| Plantae | Taxodiaceae | Taiwania spp. | Ref. |
| Plantae | Taxodiaceae | Taxodium distichum | Ref. |
| Plantae | Taxodiaceae | Taxodium mucronatum | Ref. |
|
|
zoom in
| Organism | Podocarpus macrophyllus | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 645,Biflavonyls
Miura,Chem.Pharm.Bull.,14,(1966),1404 |
|---|
|