| Name |
Myricetin 7-glucoside |
| Formula |
C21H20O13 |
| Mw |
480.09039073 |
| CAS RN |
34069-06-2 |
| C_ID |
C00005732
, 
|
| InChIKey |
VYUFSOYMUGOSGK-UXEHPGPANA-N |
| InChICode |
InChI=1S/C21H20O13/c22-5-12-15(27)17(29)19(31)21(34-12)32-7-3-8(23)13-11(4-7)33-20(18(30)16(13)28)6-1-9(24)14(26)10(25)2-6/h1-4,12,15,17,19,21-27,29-31H,5H2/t12-,15-,17+,19-,21-/m1/s1 |
| SMILES |
O=c1c(O)c(-c2cc(O)c(O)c(O)c2)oc2cc(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Semecarpus vitiensis | Ref. |
| Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum inophyllum  | Ref. |
| Plantae | Ericaceae | Cassiope mertensiana | Ref. |
| Plantae | Rubiaceae | Coprosma linariifolia | Ref. |
| Plantae | Rubiaceae | Coprosma serrulata | Ref. |
| Plantae | Saxifragaceae | Lithophragma glabrum | Ref. |
| Plantae | Saxifragaceae | Saxifraga tolmiei | Ref. |
|
|
zoom in
| Organism | Lithophragma glabrum | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Subramanian,Phytochem.,10,(1971),1679
Denford,Can.J.Bot.,53,(1975),1192 |
|---|
|