| Name |
Quercetin 3-galactoside-7-rhamnoside |
| Formula |
C27H30O16 |
| Mw |
610.15338491 |
| CAS RN |
38784-81-5 |
| C_ID |
C00005425
, 
|
| InChIKey |
OTUCXMIQUNROBJ-UPFFGDACNA-N |
| InChICode |
InChI=1S/C27H30O16/c1-8-17(32)20(35)22(37)26(39-8)40-10-5-13(31)16-14(6-10)41-24(9-2-3-11(29)12(30)4-9)25(19(16)34)43-27-23(38)21(36)18(33)15(7-28)42-27/h2-6,8,15,17-18,20-23,26-33,35-38H,7H2,1H3/t8-,15-,17+,18+,20+,21+,22-,23-,26+,27+/m1/s1 |
| SMILES |
CC1O[C@@H](Oc2cc(O)c3c(=O)c(O[C@@H]4OC(CO)[C@H](O)C(O)C4O)c(-c4ccc(O)c(O)c4)oc3c2)C(O)[C@@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cistaceae | Cistus ladaniferus  | Ref. |
| Plantae | Ericaceae | Cladothamnus pyrolaeflorus | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Fabaceae | Vicia sativa  | Ref. |
| Plantae | Ranunculaceae | Caltha palustris  | Ref. |
| Plantae | Solanaceae | Solanum spp. | Ref. |
| Plantae | Thymelaeaceae | Pimelea decora | Ref. |
|
|
zoom in
| Organism | Solanum spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Ulubelen,Z.Naturforsch.B.,25,(1970),114
Tomas-Lorente,Phytochem.,31,(1992),2027 |
|---|
|