| Name |
Kaempferol 3-O-sophoroside 7-O-beta-D-glucopyranoside:Kaempferol 3-sophoroside-7-glucoside (-)-Kaempferol 3-O-sophoroside 7-O-beta-D-glucopyranoside |
| Formula |
C33H40O21 |
| Mw |
772.20620834 |
| CAS RN |
55136-76-0 |
| C_ID |
C00005229
, 
|
| InChIKey |
MBFNAZBJKVFNKZ-YIRMBCKDNA-N |
| InChICode |
InChI=1S/C33H40O21/c34-7-15-19(39)23(43)26(46)31(50-15)48-12-5-13(38)18-14(6-12)49-28(10-1-3-11(37)4-2-10)29(22(18)42)53-33-30(25(45)21(41)17(9-36)52-33)54-32-27(47)24(44)20(40)16(8-35)51-32/h1-6,15-17,19-21,23-27,30-41,43-47H,7-9H2/t15-,16+,17+,19-,20-,21-,23+,24+,25+,26-,27-,30-,31-,32+,33+/m1/s1 |
| SMILES |
O=c1c(O[C@@H]2OC(CO)[C@@H](O)C(O)C2O[C@@H]2OC(CO)[C@@H](O)C(O)[C@H]2O)c(-c2ccc(O)cc2)oc2cc(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Amaryllidaceae | Galanthus nivalis  | Ref. |
| Plantae | Cruciferae | Brassica napus  | Ref. |
| Plantae | Cruciferae | Brassica oleracea  | Ref. |
| Plantae | Cruciferae | Brassica rapa  | Ref. |
| Plantae | Cruciferae | Sinapis arvensis  | Ref. |
| Plantae | Elaeagnaceae | Elaeagnus multiflora | Ref. |
| Plantae | Equisetaceae | Equisetum debile | Ref. |
| Plantae | Equisetaceae | Equisetum spp. | Ref. |
| Plantae | Fabaceae | Lathyrus vernus  | Ref. |
| Plantae | Hostaceae | Hosta ventricosa | Ref. |
| Plantae | Rosaceae | Potentilla spp. | Ref. |
| Plantae | Solanaceae | Nicotiana spp. | Ref. |
| Plantae | Solanaceae | Petunia x hybrida | Ref. |
|
|
zoom in
| Organism | Elaeagnus multiflora | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Harborne,Phytochem.,4,(1965),107
Griesbach,Plant Sci.,70,(1990),49 |
|---|
|