| Name |
Myricetin 5-methyl ether |
| Formula |
C16H12O8 |
| Mw |
332.05321736 |
| CAS RN |
19077-84-0 |
| C_ID |
C00004760
, 
|
| InChIKey |
DDVGNSDGGWHPQZ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O8/c1-23-10-4-7(17)5-11-12(10)14(21)15(22)16(24-11)6-2-8(18)13(20)9(19)3-6/h2-5,17-20,22H,1H3 |
| SMILES |
COc1cc(O)cc2oc(-c3cc(O)c(O)c(O)c3)c(O)c(=O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Ericaceae | Cassiope spp. | Ref. |
| Plantae | Ericaceae | Daboecia azorica | Ref. |
| Plantae | Ericaceae | Daboecia cantabrica | Ref. |
| Plantae | Ericaceae | Gaultheria veitchiana | Ref. |
| Plantae | Ericaceae | Rhododendron spp. | Ref. |
| Plantae | Plumbaginaceae | Ceratostigma spp. | Ref. |
| Plantae | Plumbaginaceae | Plumbago spp. | Ref. |
|
|
zoom in
| Organism | Ceratostigma spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Egger,Z.Naturforsch.B.,17,(1962),489 |
|---|
|