| Name |
Ternatin 5,4'-Dihydroxy-3,7,8,3'-tetramethoxyflavone Gossypetin 3,7,8,3'-tetramethyl ether 5-Hydroxy-2-(4-hydroxy-3-methoxyphenyl)-3,7,8-trimethoxy-4H-1-benzopyran-4-one |
| Formula |
C19H18O8 |
| Mw |
374.10016755 |
| CAS RN |
571-71-1 |
| C_ID |
C00004737
, 
|
| InChIKey |
DGUWNYKZOJRCQQ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H18O8/c1-23-12-7-9(5-6-10(12)20)16-19(26-4)15(22)14-11(21)8-13(24-2)17(25-3)18(14)27-16/h5-8,20-21H,1-4H3 |
| SMILES |
COc1cc(-c2oc3c(OC)c(OC)cc(O)c3c(=O)c2OC)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Egletes viscosa | Ref. |
| Plantae | Begoniaceae | Begonia glabra  | Ref. |
| Plantae | Calceolariaceae | Calceolaria tenella | Ref. |
| Plantae | Polygonaceae | Polygonum viscosum | Ref. |
| Plantae | Rutaceae | Boronia coerulescens | Ref. |
| Plantae | Rutaceae | Euodia madagascariensis | Ref. |
| Plantae | Rutaceae | Euodia viticina | Ref. |
| Plantae | Rutaceae | Evodia madagascariensis | Ref. |
| Plantae | Rutaceae | Melicope elleryana | Ref. |
| Plantae | Rutaceae | Melicope simplex | Ref. |
| Plantae | Rutaceae | Melicope ternata  | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Zygophyllaceae | Fagonia bruguieri  | Ref. |
| Plantae | Zygophyllaceae | Larrea tridentata  | Ref. |
| - | - | Didymocladium ternatum | Ref. |
| - | - | Sceptridium ternatum | Ref. |
|
|
zoom in
| Organism | Euodia madagascariensis | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Briggs,J.Chem.Soc.,(1949),2157
Briggs,J.Chem.Soc.,(1950),864 |
|---|
|