| Name |
Quercetin 3,4'-dimethyl ether 5,7,3'-Trihydroxy-3,4'-dimethoxyflavone 5,7-Dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-3-methoxy-4H-1-benzopyran-4-one |
| Formula |
C17H14O7 |
| Mw |
330.0739528 |
| CAS RN |
33429-83-3 |
| C_ID |
C00004640
, 
|
| InChIKey |
ZSPZNFOLWQEVQJ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O7/c1-22-12-4-3-8(5-10(12)19)16-17(23-2)15(21)14-11(20)6-9(18)7-13(14)24-16/h3-7,18-20H,1-2H3 |
| SMILES |
COc1ccc(-c2oc3cc(O)cc(O)c3c(=O)c2OC)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Asteriscus graveolens | Ref. |
| Plantae | Asteraceae | Baccharis sarothroides | Ref. |
| Plantae | Asteraceae | Balsamorhiza deltoidea | Ref. |
| Plantae | Asteraceae | Balsamorhiza macrophylla | Ref. |
| Plantae | Asteraceae | Brickellia arguta | Ref. |
| Plantae | Asteraceae | Calycadenia truncata | Ref. |
| Plantae | Asteraceae | Chrysothamnus viscidiflorus | Ref. |
| Plantae | Asteraceae | Flourensia cernua | Ref. |
| Plantae | Asteraceae | Grindelia tarapacana | Ref. |
| Plantae | Asteraceae | Gutierrezia texana | Ref. |
| Plantae | Asteraceae | Heterotheca inuloides | Ref. |
| Plantae | Asteraceae | Jasonia montana | Ref. |
| Plantae | Asteraceae | Psiadia dentata | Ref. |
| Plantae | Cunoniaceae | Eucryphia milliganii | Ref. |
| Plantae | Cyperaceae | Cyperus alopecuroides | Ref. |
| Plantae | Solanaceae | Petunia surfinia | Ref. |
| Plantae | Velloziaceae | Vellozia streptophylla | Ref. |
|
|
zoom in
| Organism | Calycadenia truncata | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Kupchan,Phytochem.,10,(1971),664 |
|---|
|