| Name |
Herbacetin 3,7,8-trimethyl ether 5,4'-Dihydroxy-3,7,8-trimethoxyflavone 5-Hydroxy-2-(4-hydroxyphenyl)-3,7,8-trimethoxy-4H-1-benzopyran-4-one |
| Formula |
C18H16O7 |
| Mw |
344.08960287 |
| CAS RN |
6586-29-4 |
| C_ID |
C00004619
, 
|
| InChIKey |
IUKBSFKDMZKGMT-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H16O7/c1-22-12-8-11(20)13-14(21)18(24-3)15(25-17(13)16(12)23-2)9-4-6-10(19)7-5-9/h4-8,19-20H,1-3H3 |
| SMILES |
COc1cc(O)c2c(=O)c(OC)c(-c3ccc(O)cc3)oc2c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ozothamnus spp. | Ref. |
| Plantae | Calceolariaceae | Calceolaria chelidonioides | Ref. |
| Plantae | Calceolariaceae | Calceolaria tripartita | Ref. |
| Plantae | Capparaceae | Cleome spinosa  | Ref. |
| Plantae | Euphorbiaceae | Ricinocarpos stylosus | Ref. |
| Plantae | Labiatae | Cyanostegia angustifolia | Ref. |
| Plantae | Zygophyllaceae | Fagonia bruguieri  | Ref. |
| Plantae | Zygophyllaceae | Larrea tridentata  | Ref. |
|
|
zoom in
| Organism | Cyanostegia angustifolia | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Henrick,Aust.J.Chem.,17,(1964),934 |
|---|
|