| Name |
Pollenitin 3,4',5,8-Tetrahydroxy-7-methoxyflavone 7-O-Methylherbacetin 3,5,8-Trihydroxy-2-(4-hydroxyphenyl)-7-methoxy-4H-1-benzopyran-4-one |
| Formula |
C16H12O7 |
| Mw |
316.05830274 |
| CAS RN |
24487-56-7 |
| C_ID |
C00004612
, 
|
| InChIKey |
VRODWQGSCHPDJK-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O7/c1-22-10-6-9(18)11-13(20)14(21)15(23-16(11)12(10)19)7-2-4-8(17)5-3-7/h2-6,17-19,21H,1H3 |
| SMILES |
COc1cc(O)c2c(=O)c(O)c(-c3ccc(O)cc3)oc2c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Crassulaceae | Rhodiola crenulata (HOOK.f.et Thoms.) H.OHBA | Ref. |
| Plantae | Ephedraceae | Ephedra aphylla | Ref. |
| Plantae | Polygonaceae | Atraphaxis pyrifolia | Ref. |
| Plantae | Pteridaceae | Cheilanthes argentea | Ref. |
| Plantae | Pteridaceae | Notholaena sulphurea | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
|
|
zoom in
| Organism | Camellia sinensis | | Reference | Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Sacamoto, et al., Chem Abstr, 71, (1969), 78118c
Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Sakamoto,Agric.Biol.Chem.,33,(1969),818 |
|---|
|