| Name |
Mikanin 3,5-Dihydroxy-4',6,7-trimethoxyflavone 3,5-Dihydroxy-6,7-dimethoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one |
| Formula |
C18H16O7 |
| Mw |
344.08960287 |
| CAS RN |
4324-53-2 |
| C_ID |
C00004606
, 
|
| InChIKey |
SGCYGSKAUSOJND-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H16O7/c1-22-10-6-4-9(5-7-10)17-16(21)14(19)13-11(25-17)8-12(23-2)18(24-3)15(13)20/h4-8,20-21H,1-3H3 |
| SMILES |
COc1ccc(-c2oc3cc(OC)c(OC)c(O)c3c(=O)c2O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Baccharis pilularis | Ref. |
| Plantae | Asteraceae | Helianthus x glaucus | Ref. |
| Plantae | Asteraceae | Heterotheca psammophila | Ref. |
| Plantae | Asteraceae | Mikania cordata  | Ref. |
| Plantae | Betulaceae | Alnus koehnei | Ref. |
| Plantae | Pteridaceae | Cheilanthes argentea | Ref. |
|
|
zoom in
| Organism | Alnus koehnei | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Kiang,J.Chem.Soc.,(1965),6371 |
|---|
|