| Name |
Apigenin 7,4'-diglucoside 7-(beta-D-glucopyranosyloxy)-2-[4-(beta-D-glucopyranosyloxy)phenyl]-5-hydroxy-4H-1-benzopyran-4-one |
| Formula |
C27H30O15 |
| Mw |
594.15847029 |
| CAS RN |
31737-50-5 |
| C_ID |
C00004165
, 
|
| InChIKey |
LBSOMIGNTZVUQN-PNJRDZAFNA-N |
| InChICode |
InChI=1S/C27H30O15/c28-8-17-20(32)22(34)24(36)26(41-17)38-11-3-1-10(2-4-11)15-7-14(31)19-13(30)5-12(6-16(19)40-15)39-27-25(37)23(35)21(33)18(9-29)42-27/h1-7,17-18,20-30,32-37H,8-9H2/t17-,18-,20+,21+,22-,23+,24-,25-,26+,27+/m0/s1 |
| SMILES |
O=c1cc(-c2ccc(O[C@@H]3OC(CO)[C@@H](O)C(O)C3O)cc2)oc2cc(O[C@@H]3O[C@@H](CO)[C@@H](O)C(O)C3O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Crotalaria juncea  | Ref. |
| Plantae | Fabaceae | Indigofera mysorensis | Ref. |
| Plantae | Labiatae | Salvia patens | Ref. |
| Plantae | Labiatae | Salvia ulginosa | Ref. |
| Plantae | Oxalidaceae | Oxalis corniculata  | Ref. |
| Plantae | Taxaceae | Taxus baccata  | Ref. |
|
|
zoom in
| Organism | Taxus baccata | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 3.Flavone O-glycosides, John Wiley & Son
Harborne,Comparative Biochemistry of the Flavonoids,(1967),47,Academic Press |
|---|
|