| Name |
Eupalestin Conyzorigun 5,6,7,8-Tetramethoxy-2-(7-methoxy-1,3-benzodioxol-5-yl)-4H-1-benzopyran-4-one |
| Formula |
C21H20O9 |
| Mw |
416.11073224 |
| CAS RN |
73340-44-0 |
| C_ID |
C00004008
, 
|
| InChIKey |
YPFLOZZPZVKXBX-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C21H20O9/c1-23-13-6-10(7-14-16(13)29-9-28-14)12-8-11(22)15-17(24-2)19(25-3)21(27-5)20(26-4)18(15)30-12/h6-8H,9H2,1-5H3 |
| SMILES |
COc1cc(-c2cc(=O)c3c(OC)c(OC)c(OC)c(OC)c3o2)cc2c1OCO2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ageratina conyzoides | Ref. |
| Plantae | Asteraceae | Ageratum conyzoides  | Ref. |
| Plantae | Asteraceae | Ageratum corymbosum | Ref. |
| Plantae | Asteraceae | Ageratum tomentosum | Ref. |
| Plantae | Asteraceae | Eupatorium coelestinum | Ref. |
| Plantae | Asteraceae | Eupatorium leucolepsis | Ref. |
| Plantae | Asteraceae | Ozothamnus lycopodioides | Ref. |
|
|
zoom in
| Organism | Eupatorium leucolepsis | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Le Van,Phytochem.,18,(1979),1859
Vazquez,Phytochem.,27,(1988),3706 |
|---|
|