| Name |
Linderoflavone B Lucidin dimethyl ether 5,6,7,8-Tetramethoxy-3',4'-(methylenedioxy)flavone 2-(1,3-Benzodioxol-5-yl)-5,6,7,8-tetramethoxy-4H-1-benzopyran-4-one |
| Formula |
C20H18O8 |
| Mw |
386.10016755 |
| CAS RN |
3162-42-3 |
| C_ID |
C00004005
, 
|
| InChIKey |
LKUJKDQDJLCGCT-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H18O8/c1-22-16-15-11(21)8-13(10-5-6-12-14(7-10)27-9-26-12)28-17(15)19(24-3)20(25-4)18(16)23-2/h5-8H,9H2,1-4H3 |
| SMILES |
COc1c(OC)c(OC)c2c(=O)cc(-c3ccc4c(c3)OCO4)oc2c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ageratina conyzoides | Ref. |
| Plantae | Asteraceae | Ageratum conyzoides  | Ref. |
| Plantae | Asteraceae | Ageratum tomentosum | Ref. |
| Plantae | Asteraceae | Eupatorium leucolepsis | Ref. |
| Plantae | Asteraceae | Ozothamnus lycopodioides | Ref. |
| Plantae | Lauraceae | Lindera lucida | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
|
|
zoom in
| Organism | Lindera lucida | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Lee,J.Chem.Soc.,(1965),6255
Gonzalez,Phytochem.,30,(1991),1269 |
|---|
|