| Name |
4 5,6-Dihydroxy-7,3',4'-trimethoxyflavone 6-Hydroxyluteolin 7,3',4'-trimethyl ether 5,6-Dihydroxy-7,3',4'-Trimethoxyflavone 2-(3,4-Dimethoxyphenyl)-5,6-dihydroxy-7-methoxy-4H-1-benzopyran-4-one |
| Formula |
C18H16O7 |
| Mw |
344.08960287 |
| CAS RN |
25782-23-4 |
| C_ID |
C00003895
, 
|
| InChIKey |
QIEMGQKOGFTYLN-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H16O7/c1-22-11-5-4-9(6-13(11)23-2)12-7-10(19)16-14(25-12)8-15(24-3)17(20)18(16)21/h4-8,20-21H,1-3H3 |
| SMILES |
COc1ccc(-c2cc(=O)c3c(O)c(O)c(OC)cc3o2)cc1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Artemisia argyi  | Ref. |
| Plantae | Labiatae | Clinopodium nepeta | Ref. |
| Plantae | Labiatae | Mentha x piperita | Ref. |
| Plantae | Labiatae | Micromeria spp. | Ref. |
| Plantae | Labiatae | Ocimum lamiifolium  | Ref. |
| Plantae | Labiatae | Origanum calcaratum | Ref. |
| Plantae | Labiatae | Origanum dictamnus  | Ref. |
| Plantae | Labiatae | Origanum floribundum | Ref. |
| Plantae | Labiatae | Origanum majorana  | Ref. |
| Plantae | Labiatae | Origanum microphyllum | Ref. |
| Plantae | Labiatae | Origanum onites  | Ref. |
| Plantae | Labiatae | Origanum syriacum  | Ref. |
| Plantae | Labiatae | Origanum vulgare subsp. Glandulosum  | Ref. |
| Plantae | Labiatae | Origanum vulgare subsp. Hirtum  | Ref. |
| Plantae | Labiatae | Salvia sclarea  | Ref. |
| Plantae | Labiatae | Salvia syriaca | Ref. |
| Plantae | Labiatae | Satureja thymbra  | Ref. |
| Plantae | Labiatae | Thymbra capitata  | Ref. |
| Plantae | Labiatae | Thymbra spicata | Ref. |
| Plantae | Labiatae | Thymus piperella  | Ref. |
| Plantae | Lamiaceae | Calamintha nepeta  | Ref. |
|
|
zoom in
| Organism | Origanum calcaratum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|