| Name |
Luteolin 3',4'-dimethyl ether 5,7-Dihydroxy-3',4'-dimethoxyflavone 2-(3,4-Dimethoxyphenyl)-5,7-dihydroxy-4H-1-benzopyran-4-one |
| Formula |
C17H14O6 |
| Mw |
314.07903818 |
| CAS RN |
4712-12-3 |
| C_ID |
C00003869
, 
|
| InChIKey |
AOLOMULCAJQEIG-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O6/c1-21-13-4-3-9(5-15(13)22-2)14-8-12(20)17-11(19)6-10(18)7-16(17)23-14/h3-8,18-19H,1-2H3 |
| SMILES |
COc1ccc(-c2cc(=O)c3c(O)cc(O)cc3o2)cc1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Calea ternifolia | Ref. |
| Plantae | Asteraceae | Chrysothamnus nauseosus | Ref. |
| Plantae | Asteraceae | Chrysothamnus viscidiflorus | Ref. |
| Plantae | Asteraceae | Eremanthus arboreus | Ref. |
| Plantae | Fabaceae | Ononis vaginalis | Ref. |
| Plantae | Fabaceae | Rhynchosia beddomei | Ref. |
| Plantae | Labiatae | Salvia nicolsoniana | Ref. |
| Plantae | Monocleaceae | Monoclea forsteri | Ref. |
| Plantae | Monocleaceae | Monoclea gottschei | Ref. |
| Plantae | Orobanchaceae | Striga asiatica  | Ref. |
| Plantae | Plantaginaceae | Asarina barclaiana | Ref. |
|
|
zoom in
| Organism | Rhynchosia beddomei | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Adinarayana,Phytochem.,19,(1980),480
Perada-Miranda,J.NatProd.,49,(1986),1160 |
|---|
|