| Name |
Bucegin Galangustin 5,7-Dihydroxy-8-methoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one |
| Formula |
C17H14O6 |
| Mw |
314.07903818 |
| CAS RN |
65501-87-3 |
| C_ID |
C00003853
, 
|
| InChIKey |
MRQSJFKGZKPPNM-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O6/c1-21-10-5-3-9(4-6-10)14-8-12(19)15-11(18)7-13(20)16(22-2)17(15)23-14/h3-8,18,20H,1-2H3 |
| SMILES |
COc1ccc(-c2cc(=O)c3c(O)cc(O)c(OC)c3o2)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Chrysothamnus nauseosus | Ref. |
| Plantae | Asteraceae | Madia sativa  | Ref. |
| Plantae | Asteraceae | Zinnia acerosa | Ref. |
| Plantae | Calceolariaceae | Calceolaria irazeunsis | Ref. |
| Plantae | Cunoniaceae | Eucryphia jinksii | Ref. |
| Plantae | Marchantiaceae | Bucegia romanica | Ref. |
|
|
zoom in
| Organism | Bucegia romanica | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Markham,Phytochem.,22,(1983),143 |
|---|
|