| Name |
Echioidinin |
| Formula |
C16H12O5 |
| Mw |
284.06847349 |
| CAS RN |
4308-56-9 |
| C_ID |
C00003816
, 
|
| InChIKey |
PXFLNHWWYOVFDA-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O5/c1-20-9-6-12(18)16-13(19)8-14(21-15(16)7-9)10-4-2-3-5-11(10)17/h2-8,17-18H,1H3 |
| SMILES |
COc1cc(O)c2c(=O)cc(-c3ccccc3O)oc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Andrographis alata | Ref. |
| Plantae | Acanthaceae | Andrographis echioides  | Ref. |
| Plantae | Acanthaceae | Andrographis lineata  | Ref. |
| Plantae | Acanthaceae | Andrographis rothii | Ref. |
| Plantae | Acanthaceae | Andrographis viscosula | Ref. |
| Plantae | Acanthaceae | Andrographis wightiana | Ref. |
|
|
zoom in
| Organism | Andrographis wightiana | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Govindachari, Tetrahedron,21,(1965)2633
Farkas,Tetrahedron,23,(1967)741 |
|---|
|