| Name |
Mosloflavone 5-Hydroxy-6,7-Dimethoxyflavone |
| Formula |
C17H14O5 |
| Mw |
298.08412356 |
| CAS RN |
740-33-0 |
| C_ID |
C00003807
, 
|
| InChIKey |
SIVAITYPYQQYAP-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O5/c1-20-14-9-13-15(16(19)17(14)21-2)11(18)8-12(22-13)10-6-4-3-5-7-10/h3-9,19H,1-2H3 |
| SMILES |
COc1cc2oc(-c3ccccc3)cc(=O)c2c(O)c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Popowia cauliflora | Ref. |
| Plantae | Annonaceae | Uvaria ruf | Ref. |
| Plantae | Labiatae | Mosla soochouensis | Ref. |
| Plantae | Labiatae | Origanum akhadarense | Ref. |
| Plantae | Labiatae | Origanum boissieri | Ref. |
| Plantae | Labiatae | Origanum dictamnus  | Ref. |
| Plantae | Labiatae | Origanum hypercifolium | Ref. |
| Plantae | Labiatae | Origanum majoricum | Ref. |
| Plantae | Labiatae | Origanum micranthum | Ref. |
| Plantae | Labiatae | Origanum vulgare  | Ref. |
|
|
zoom in
| Organism | Origanum dictamnus | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|